C17H19ClFN3O2S — CID 21008738
1-(3-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-morpholin-4-ylethyl]thiourea (PubChem CID 21008738) has the molecular formula C17H19ClFN3O2S and a molecular weight of 383.88 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-morpholin-4-ylethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-morpholin-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 21008738 |
| Molecular Formula | C17H19ClFN3O2S |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(furan-2-yl)-2-morpholin-4-ylethyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NCC(c2ccco2)N2CCOCC2)cc1Cl |
| InChI | InChI=1S/C17H19ClFN3O2S/c18-13-10-12(3-4-14(13)19)21-17(25)20-11-15(16-2-1-7-24-16)22-5-8-23-9-6-22/h1-4,7,10,15H,5-6,8-9,11H2,(H2,20,21,25) |
| InChIKey | ZIKPWDQVEAXCGF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|