C17H20ClFN3OS+ — CID 8675829
1-(3-chloro-4-fluorophenyl)-3-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea (PubChem CID 8675829) has the molecular formula C17H20ClFN3OS+ and a molecular weight of 368.89 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8675829 |
| Molecular Formula | C17H20ClFN3OS+ |
| Molecular Weight | 368.89 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NC[C@H](c2ccco2)[NH+]2CCCC2)cc1Cl |
| InChI | InChI=1S/C17H19ClFN3OS/c18-13-10-12(5-6-14(13)19)21-17(24)20-11-15(16-4-3-9-23-16)22-7-1-2-8-22/h3-6,9-10,15H,1-2,7-8,11H2,(H2,20,21,24)/p+1/t15-/m1/s1 |
| InChIKey | PQGBMNNZCUHIDO-OAHLLOKOSA-O |
| XLogP | 2.78 |
| TPSA | 41.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.89 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|