C18H24N3O2S+ — CID 2440649
1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 2440649) has the molecular formula C18H24N3O2S+ and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 2440649 |
| Molecular Formula | C18H24N3O2S+ |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NC[C@@H](c2ccco2)[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C18H23N3O2S/c1-22-15-8-6-14(7-9-15)20-18(24)19-13-16(17-5-4-12-23-17)21-10-2-3-11-21/h4-9,12,16H,2-3,10-11,13H2,1H3,(H2,19,20,24)/p+1/t16-/m0/s1 |
| InChIKey | WNBMZXFIUBSYBJ-INIZCTEOSA-O |
| XLogP | 1.99 |
| TPSA | 50.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|