C17H21FN3O2+ — CID 9318401
1-(4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]urea (PubChem CID 9318401) has the molecular formula C17H21FN3O2+ and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]urea |
|---|---|
| PubChem CID | 9318401 |
| Molecular Formula | C17H21FN3O2+ |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]urea |
| SMILES | O=C(NC[C@@H](c1ccco1)[NH+]1CCCC1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O2/c18-13-5-7-14(8-6-13)20-17(22)19-12-15(16-4-3-11-23-16)21-9-1-2-10-21/h3-8,11,15H,1-2,9-10,12H2,(H2,19,20,22)/p+1/t15-/m0/s1 |
| InChIKey | WBCBBKURDAISTA-HNNXBMFYSA-O |
| XLogP | 1.96 |
| TPSA | 58.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |