C18H23FN3OS+ — CID 8787990
1-(2-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]thiourea (PubChem CID 8787990) has the molecular formula C18H23FN3OS+ and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]thiourea.
| Compound Name | 1-(2-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8787990 |
| Molecular Formula | C18H23FN3OS+ |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1-(2-fluorophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]thiourea |
| SMILES | Fc1ccccc1NC(=S)NC[C@@H](c1ccco1)[NH+]1CCCCC1 |
| InChI | InChI=1S/C18H22FN3OS/c19-14-7-2-3-8-15(14)21-18(24)20-13-16(17-9-6-12-23-17)22-10-4-1-5-11-22/h2-3,6-9,12,16H,1,4-5,10-11,13H2,(H2,20,21,24)/p+1/t16-/m0/s1 |
| InChIKey | NDVGEINTIHKSFL-INIZCTEOSA-O |
| XLogP | 2.52 |
| TPSA | 41.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|