C18H21F3N3OS+ — CID 7831866
1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 7831866) has the molecular formula C18H21F3N3OS+ and a molecular weight of 384.45 g/mol. Its IUPAC name is 1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 7831866 |
| Molecular Formula | C18H21F3N3OS+ |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 1-[(2R)-2-(furan-2-yl)-2-pyrrolidin-1-ium-1-ylethyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | FC(F)(F)c1cccc(NC(=S)NC[C@H](c2ccco2)[NH+]2CCCC2)c1 |
| InChI | InChI=1S/C18H20F3N3OS/c19-18(20,21)13-5-3-6-14(11-13)23-17(26)22-12-15(16-7-4-10-25-16)24-8-1-2-9-24/h3-7,10-11,15H,1-2,8-9,12H2,(H2,22,23,26)/p+1/t15-/m1/s1 |
| InChIKey | KRPIYDWMPXUBNC-OAHLLOKOSA-O |
| XLogP | 3.00 |
| TPSA | 41.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|