C18H21F3N3O3+ — CID 8894644
N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2-nitro-4-(trifluoromethyl)aniline (PubChem CID 8894644) has the molecular formula C18H21F3N3O3+ and a molecular weight of 384.38 g/mol. Its IUPAC name is N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2-nitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2-nitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 8894644 |
| Molecular Formula | C18H21F3N3O3+ |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[(2S)-2-(furan-2-yl)-2-piperidin-1-ium-1-ylethyl]-2-nitro-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NC[C@@H](c1ccco1)[NH+]1CCCCC1 |
| InChI | InChI=1S/C18H20F3N3O3/c19-18(20,21)13-6-7-14(15(11-13)24(25)26)22-12-16(17-5-4-10-27-17)23-8-2-1-3-9-23/h4-7,10-11,16,22H,1-3,8-9,12H2/p+1/t16-/m0/s1 |
| InChIKey | MMBQFCKHMLAAAQ-INIZCTEOSA-O |
| XLogP | 3.43 |
| TPSA | 72.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|