C11H8F3N3O3 — CID 79492292
2-nitro-N-(1,2-oxazol-3-ylmethyl)-4-(trifluoromethyl)aniline (PubChem CID 79492292) has the molecular formula C11H8F3N3O3 and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-nitro-N-(1,2-oxazol-3-ylmethyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-nitro-N-(1,2-oxazol-3-ylmethyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 79492292 |
| Molecular Formula | C11H8F3N3O3 |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 2-nitro-N-(1,2-oxazol-3-ylmethyl)-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCc1ccon1 |
| InChI | InChI=1S/C11H8F3N3O3/c12-11(13,14)7-1-2-9(10(5-7)17(18)19)15-6-8-3-4-20-16-8/h1-5,15H,6H2 |
| InChIKey | ZGDZNXPDXSBGBM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|