C10H10N4O3 — CID 81170399
4-nitro-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine (PubChem CID 81170399) has the molecular formula C10H10N4O3 and a molecular weight of 234.22 g/mol. Its IUPAC name is 4-nitro-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-nitro-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 81170399 |
| Molecular Formula | C10H10N4O3 |
| Molecular Weight | 234.22 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-nitro-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc([N+](=O)[O-])ccc1NCc1ccon1 |
| InChI | InChI=1S/C10H10N4O3/c11-9-5-8(14(15)16)1-2-10(9)12-6-7-3-4-17-13-7/h1-5,12H,6,11H2 |
| InChIKey | NEUZDTXJZQWOPW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|