C11H11F2N3O — CID 112737532
4-(difluoromethyl)-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine (PubChem CID 112737532) has the molecular formula C11H11F2N3O and a molecular weight of 239.23 g/mol. Its IUPAC name is 4-(difluoromethyl)-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine.
| Compound Name | 4-(difluoromethyl)-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 112737532 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 4-(difluoromethyl)-1-N-(1,2-oxazol-3-ylmethyl)benzene-1,2-diamine |
| SMILES | Nc1cc(C(F)F)ccc1NCc1ccon1 |
| InChI | InChI=1S/C11H11F2N3O/c12-11(13)7-1-2-10(9(14)5-7)15-6-8-3-4-17-16-8/h1-5,11,15H,6,14H2 |
| InChIKey | DMUYRUAMHRNWFY-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|