C14H12F3N3O2 — CID 3783366
2-nitro-N-(2-pyridin-2-ylethyl)-4-(trifluoromethyl)aniline (PubChem CID 3783366) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-nitro-N-(2-pyridin-2-ylethyl)-4-(trifluoromethyl)aniline.
| Compound Name | 2-nitro-N-(2-pyridin-2-ylethyl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 3783366 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-nitro-N-(2-pyridin-2-ylethyl)-4-(trifluoromethyl)aniline |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1NCCc1ccccn1 |
| InChI | InChI=1S/C14H12F3N3O2/c15-14(16,17)10-4-5-12(13(9-10)20(21)22)19-8-6-11-3-1-2-7-18-11/h1-5,7,9,19H,6,8H2 |
| InChIKey | WKSFVXMDSHNPGS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|