C18H20N4O3 — CID 16558694
4-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-3-nitrobenzonitrile (PubChem CID 16558694) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-3-nitrobenzonitrile.
| Compound Name | 4-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 16558694 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 4-[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(NCC(c2ccco2)N2CCCCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H20N4O3/c19-12-14-6-7-15(16(11-14)22(23)24)20-13-17(18-5-4-10-25-18)21-8-2-1-3-9-21/h4-7,10-11,17,20H,1-3,8-9,13H2 |
| InChIKey | QVJUKFLHTLGMOV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|