C19H23N3O — CID 47014029
3-[[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile (PubChem CID 47014029) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 47014029 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 3-[[[2-(furan-2-yl)-2-piperidin-1-ylethyl]amino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCC(c2ccco2)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H23N3O/c20-13-16-6-4-7-17(12-16)14-21-15-18(19-8-5-11-23-19)22-9-2-1-3-10-22/h4-8,11-12,18,21H,1-3,9-10,14-15H2 |
| InChIKey | MRSBUUKJEJQGHR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 52.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |