C20H22FN3O — CID 94182908
3-[[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methyl]benzonitrile (PubChem CID 94182908) has the molecular formula C20H22FN3O and a molecular weight of 339.41 g/mol. Its IUPAC name is 3-[[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 94182908 |
| Molecular Formula | C20H22FN3O |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 3-[[[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]amino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNC[C@@H](c2ccc(F)cc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H22FN3O/c21-19-6-4-18(5-7-19)20(24-8-10-25-11-9-24)15-23-14-17-3-1-2-16(12-17)13-22/h1-7,12,20,23H,8-11,14-15H2/t20-/m0/s1 |
| InChIKey | XBZOVYPFYSWCFS-FQEVSTJZSA-N |
| XLogP | 2.86 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |