C23H29N3O2 — CID 119108874
4-[3-[[(2-morpholin-4-yl-2-phenylethyl)amino]methyl]phenoxy]butanenitrile (PubChem CID 119108874) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 4-[3-[[(2-morpholin-4-yl-2-phenylethyl)amino]methyl]phenoxy]butanenitrile.
| Compound Name | 4-[3-[[(2-morpholin-4-yl-2-phenylethyl)amino]methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 119108874 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 4-[3-[[(2-morpholin-4-yl-2-phenylethyl)amino]methyl]phenoxy]butanenitrile |
| SMILES | N#CCCCOc1cccc(CNCC(c2ccccc2)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H29N3O2/c24-11-4-5-14-28-22-10-6-7-20(17-22)18-25-19-23(21-8-2-1-3-9-21)26-12-15-27-16-13-26/h1-3,6-10,17,23,25H,4-5,12-16,18-19H2 |
| InChIKey | FKNIMMAJOYNQFJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|