C19H21ClFN3O — CID 56796595
3-[[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]methyl]benzonitrile;hydrochloride (PubChem CID 56796595) has the molecular formula C19H21ClFN3O and a molecular weight of 361.85 g/mol. Its IUPAC name is 3-[[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]methyl]benzonitrile;hydrochloride.
| Compound Name | 3-[[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]methyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 56796595 |
| Molecular Formula | C19H21ClFN3O |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | 3-[[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]methyl]benzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccc(CNCc2ccc(N3CCOCC3)c(F)c2)c1 |
| InChI | InChI=1S/C19H20FN3O.ClH/c20-18-11-17(4-5-19(18)23-6-8-24-9-7-23)14-22-13-16-3-1-2-15(10-16)12-21;/h1-5,10-11,22H,6-9,13-14H2;1H |
| InChIKey | ZRJLJCCWQVOFRX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|