C20H20FN3O2 — CID 133456496
4-acetyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]benzonitrile (PubChem CID 133456496) has the molecular formula C20H20FN3O2 and a molecular weight of 353.40 g/mol. Its IUPAC name is 4-acetyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]benzonitrile.
| Compound Name | 4-acetyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 133456496 |
| Molecular Formula | C20H20FN3O2 |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 4-acetyl-2-[(3-fluoro-4-morpholin-4-ylphenyl)methylamino]benzonitrile |
| SMILES | CC(=O)c1ccc(C#N)c(NCc2ccc(N3CCOCC3)c(F)c2)c1 |
| InChI | InChI=1S/C20H20FN3O2/c1-14(25)16-3-4-17(12-22)19(11-16)23-13-15-2-5-20(18(21)10-15)24-6-8-26-9-7-24/h2-5,10-11,23H,6-9,13H2,1H3 |
| InChIKey | PRLGFAGYNRBZJC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |