C18H28FN3O3 — CID 87037648
1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-(3-propan-2-yloxypropyl)urea (PubChem CID 87037648) has the molecular formula C18H28FN3O3 and a molecular weight of 353.44 g/mol. Its IUPAC name is 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 87037648 |
| Molecular Formula | C18H28FN3O3 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-[(3-fluoro-4-morpholin-4-ylphenyl)methyl]-3-(3-propan-2-yloxypropyl)urea |
| SMILES | CC(C)OCCCNC(=O)NCc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C18H28FN3O3/c1-14(2)25-9-3-6-20-18(23)21-13-15-4-5-17(16(19)12-15)22-7-10-24-11-8-22/h4-5,12,14H,3,6-11,13H2,1-2H3,(H2,20,21,23) |
| InChIKey | AECYOWKKPBHMHL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|