C17H26FN3O2 — CID 110900135
1-butyl-3-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]urea (PubChem CID 110900135) has the molecular formula C17H26FN3O2 and a molecular weight of 323.41 g/mol. Its IUPAC name is 1-butyl-3-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]urea.
| Compound Name | 1-butyl-3-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 110900135 |
| Molecular Formula | C17H26FN3O2 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 1-butyl-3-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]urea |
| SMILES | CCCCNC(=O)NCc1ccc(N2CCC(O)CC2)c(F)c1 |
| InChI | InChI=1S/C17H26FN3O2/c1-2-3-8-19-17(23)20-12-13-4-5-16(15(18)11-13)21-9-6-14(22)7-10-21/h4-5,11,14,22H,2-3,6-10,12H2,1H3,(H2,19,20,23) |
| InChIKey | MQKZGSJBYCPSOM-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|