C18H26FN3O2 — CID 109397854
1-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(1-methylcyclobutyl)urea (PubChem CID 109397854) has the molecular formula C18H26FN3O2 and a molecular weight of 335.42 g/mol. Its IUPAC name is 1-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(1-methylcyclobutyl)urea.
| Compound Name | 1-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(1-methylcyclobutyl)urea |
|---|---|
| PubChem CID | 109397854 |
| Molecular Formula | C18H26FN3O2 |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]-3-(1-methylcyclobutyl)urea |
| SMILES | CC1(NC(=O)NCc2ccc(N3CCC(O)CC3)c(F)c2)CCC1 |
| InChI | InChI=1S/C18H26FN3O2/c1-18(7-2-8-18)21-17(24)20-12-13-3-4-16(15(19)11-13)22-9-5-14(23)6-10-22/h3-4,11,14,23H,2,5-10,12H2,1H3,(H2,20,21,24) |
| InChIKey | ZOFPZDKRMQIIDE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |