C25H26FN3O2 — CID 60579710
2-anilino-N-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]benzamide (PubChem CID 60579710) has the molecular formula C25H26FN3O2 and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-anilino-N-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]benzamide.
| Compound Name | 2-anilino-N-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 60579710 |
| Molecular Formula | C25H26FN3O2 |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-anilino-N-[[3-fluoro-4-(4-hydroxypiperidin-1-yl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(N2CCC(O)CC2)c(F)c1)c1ccccc1Nc1ccccc1 |
| InChI | InChI=1S/C25H26FN3O2/c26-22-16-18(10-11-24(22)29-14-12-20(30)13-15-29)17-27-25(31)21-8-4-5-9-23(21)28-19-6-2-1-3-7-19/h1-11,16,20,28,30H,12-15,17H2,(H,27,31) |
| InChIKey | XTKXRGTWXJPPGU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |