C14H21FN2O2 — CID 145422161
ethane;N-(3-fluoro-4-morpholin-4-ylphenyl)acetamide (PubChem CID 145422161) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is ethane;N-(3-fluoro-4-morpholin-4-ylphenyl)acetamide.
| Compound Name | ethane;N-(3-fluoro-4-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 145422161 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | ethane;N-(3-fluoro-4-morpholin-4-ylphenyl)acetamide |
| SMILES | CC.CC(=O)Nc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C12H15FN2O2.C2H6/c1-9(16)14-10-2-3-12(11(13)8-10)15-4-6-17-7-5-15;1-2/h2-3,8H,4-7H2,1H3,(H,14,16);1-2H3 |
| InChIKey | LQBDUNMDWSQHAR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|