C12H17FN2O — CID 123788462
N-ethyl-3-fluoro-4-morpholin-4-ylaniline (PubChem CID 123788462) has the molecular formula C12H17FN2O and a molecular weight of 224.28 g/mol. Its IUPAC name is N-ethyl-3-fluoro-4-morpholin-4-ylaniline.
| Compound Name | N-ethyl-3-fluoro-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 123788462 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-ethyl-3-fluoro-4-morpholin-4-ylaniline |
| SMILES | CCNc1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C12H17FN2O/c1-2-14-10-3-4-12(11(13)9-10)15-5-7-16-8-6-15/h3-4,9,14H,2,5-8H2,1H3 |
| InChIKey | JUZPATNHNIZSAN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|