C14H21FN2O3 — CID 66700439
N-(2,2-dimethoxyethyl)-3-fluoro-4-morpholin-4-ylaniline (PubChem CID 66700439) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-fluoro-4-morpholin-4-ylaniline.
| Compound Name | N-(2,2-dimethoxyethyl)-3-fluoro-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 66700439 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-fluoro-4-morpholin-4-ylaniline |
| SMILES | COC(CNc1ccc(N2CCOCC2)c(F)c1)OC |
| InChI | InChI=1S/C14H21FN2O3/c1-18-14(19-2)10-16-11-3-4-13(12(15)9-11)17-5-7-20-8-6-17/h3-4,9,14,16H,5-8,10H2,1-2H3 |
| InChIKey | MMLXVYWQVAHLTA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|