C16H23FN2O3 — CID 11709354
N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline (PubChem CID 11709354) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline.
| Compound Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 11709354 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-[[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline |
| SMILES | CC1(C)OC[C@@H](CNc2ccc(N3CCOCC3)c(F)c2)O1 |
| InChI | InChI=1S/C16H23FN2O3/c1-16(2)21-11-13(22-16)10-18-12-3-4-15(14(17)9-12)19-5-7-20-8-6-19/h3-4,9,13,18H,5-8,10-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | IVQAJBUNBJQHOV-CYBMUJFWSA-N |
| XLogP | 2.23 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|