C24H39FN4O2 — CID 160755864
3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-4-morpholin-4-ylaniline;1-methylpiperidine-4-carbaldehyde (PubChem CID 160755864) has the molecular formula C24H39FN4O2 and a molecular weight of 434.60 g/mol. Its IUPAC name is 3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-4-morpholin-4-ylaniline;1-methylpiperidine-4-carbaldehyde.
| Compound Name | 3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-4-morpholin-4-ylaniline;1-methylpiperidine-4-carbaldehyde |
|---|---|
| PubChem CID | 160755864 |
| Molecular Formula | C24H39FN4O2 |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | 3-fluoro-N-[(1-methylpiperidin-4-yl)methyl]-4-morpholin-4-ylaniline;1-methylpiperidine-4-carbaldehyde |
| SMILES | CN1CCC(C=O)CC1.CN1CCC(CNc2ccc(N3CCOCC3)c(F)c2)CC1 |
| InChI | InChI=1S/C17H26FN3O.C7H13NO/c1-20-6-4-14(5-7-20)13-19-15-2-3-17(16(18)12-15)21-8-10-22-11-9-21;1-8-4-2-7(6-9)3-5-8/h2-3,12,14,19H,4-11,13H2,1H3;6-7H,2-5H2,1H3 |
| InChIKey | RXKOVGMRISMASW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|