C27H40FN3O2 — CID 69038632
(4-tert-butylcyclohexyl)-[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone (PubChem CID 69038632) has the molecular formula C27H40FN3O2 and a molecular weight of 457.63 g/mol. Its IUPAC name is (4-tert-butylcyclohexyl)-[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone.
| Compound Name | (4-tert-butylcyclohexyl)-[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone |
|---|---|
| PubChem CID | 69038632 |
| Molecular Formula | C27H40FN3O2 |
| Molecular Weight | 457.63 g/mol |
| Exact Mass | 457.31 |
| IUPAC Name | (4-tert-butylcyclohexyl)-[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methanone |
| SMILES | CC(C)(C)C1CCC(C(=O)N2CC3C(CNc4ccc(N5CCOCC5)c(F)c4)C3C2)CC1 |
| InChI | InChI=1S/C27H40FN3O2/c1-27(2,3)19-6-4-18(5-7-19)26(32)31-16-22-21(23(22)17-31)15-29-20-8-9-25(24(28)14-20)30-10-12-33-13-11-30/h8-9,14,18-19,21-23,29H,4-7,10-13,15-17H2,1-3H3 |
| InChIKey | YLXFZOAEYIJWNH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.63 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|