C23H27F2N3O3S — CID 69088627
3-fluoro-N-[[3-[(4-fluorophenyl)methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-morpholin-4-ylaniline (PubChem CID 69088627) has the molecular formula C23H27F2N3O3S and a molecular weight of 463.55 g/mol. Its IUPAC name is 3-fluoro-N-[[3-[(4-fluorophenyl)methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-morpholin-4-ylaniline.
| Compound Name | 3-fluoro-N-[[3-[(4-fluorophenyl)methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 69088627 |
| Molecular Formula | C23H27F2N3O3S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-fluoro-N-[[3-[(4-fluorophenyl)methylsulfonyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-4-morpholin-4-ylaniline |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)N1CC2C(CNc3ccc(N4CCOCC4)c(F)c3)C2C1 |
| InChI | InChI=1S/C23H27F2N3O3S/c24-17-3-1-16(2-4-17)15-32(29,30)28-13-20-19(21(20)14-28)12-26-18-5-6-23(22(25)11-18)27-7-9-31-10-8-27/h1-6,11,19-21,26H,7-10,12-15H2 |
| InChIKey | XTAWAQRZSMYEPE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|