C28H29ClFN3O4S — CID 69033986
N-[[3-[3-(4-chlorophenoxy)phenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline (PubChem CID 69033986) has the molecular formula C28H29ClFN3O4S and a molecular weight of 558.08 g/mol. Its IUPAC name is N-[[3-[3-(4-chlorophenoxy)phenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline.
| Compound Name | N-[[3-[3-(4-chlorophenoxy)phenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline |
|---|---|
| PubChem CID | 69033986 |
| Molecular Formula | C28H29ClFN3O4S |
| Molecular Weight | 558.08 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | N-[[3-[3-(4-chlorophenoxy)phenyl]sulfonyl-3-azabicyclo[3.1.0]hexan-6-yl]methyl]-3-fluoro-4-morpholin-4-ylaniline |
| SMILES | O=S(=O)(c1cccc(Oc2ccc(Cl)cc2)c1)N1CC2C(CNc3ccc(N4CCOCC4)c(F)c3)C2C1 |
| InChI | InChI=1S/C28H29ClFN3O4S/c29-19-4-7-21(8-5-19)37-22-2-1-3-23(15-22)38(34,35)33-17-25-24(26(25)18-33)16-31-20-6-9-28(27(30)14-20)32-10-12-36-13-11-32/h1-9,14-15,24-26,31H,10-13,16-18H2 |
| InChIKey | WJPOKPPUYZDLFA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|