C23H34FN3O2 — CID 69035571
1-[[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methyl]cyclohexan-1-ol (PubChem CID 69035571) has the molecular formula C23H34FN3O2 and a molecular weight of 403.54 g/mol. Its IUPAC name is 1-[[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 69035571 |
| Molecular Formula | C23H34FN3O2 |
| Molecular Weight | 403.54 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | 1-[[6-[(3-fluoro-4-morpholin-4-ylanilino)methyl]-3-azabicyclo[3.1.0]hexan-3-yl]methyl]cyclohexan-1-ol |
| SMILES | OC1(CN2CC3C(CNc4ccc(N5CCOCC5)c(F)c4)C3C2)CCCCC1 |
| InChI | InChI=1S/C23H34FN3O2/c24-21-12-17(4-5-22(21)27-8-10-29-11-9-27)25-13-18-19-14-26(15-20(18)19)16-23(28)6-2-1-3-7-23/h4-5,12,18-20,25,28H,1-3,6-11,13-16H2 |
| InChIKey | GKEBUTCNGQSEHM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|