C26H34FN3O4 — CID 69037340
3-fluoro-4-morpholin-4-yl-N-[[3-[(3,4,5-trimethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]aniline (PubChem CID 69037340) has the molecular formula C26H34FN3O4 and a molecular weight of 471.57 g/mol. Its IUPAC name is 3-fluoro-4-morpholin-4-yl-N-[[3-[(3,4,5-trimethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]aniline.
| Compound Name | 3-fluoro-4-morpholin-4-yl-N-[[3-[(3,4,5-trimethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]aniline |
|---|---|
| PubChem CID | 69037340 |
| Molecular Formula | C26H34FN3O4 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | 3-fluoro-4-morpholin-4-yl-N-[[3-[(3,4,5-trimethoxyphenyl)methyl]-3-azabicyclo[3.1.0]hexan-6-yl]methyl]aniline |
| SMILES | COc1cc(CN2CC3C(CNc4ccc(N5CCOCC5)c(F)c4)C3C2)cc(OC)c1OC |
| InChI | InChI=1S/C26H34FN3O4/c1-31-24-10-17(11-25(32-2)26(24)33-3)14-29-15-20-19(21(20)16-29)13-28-18-4-5-23(22(27)12-18)30-6-8-34-9-7-30/h4-5,10-12,19-21,28H,6-9,13-16H2,1-3H3 |
| InChIKey | ABZZDCRFMZKNOE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|