C19H20BrFN2O4 — CID 56500087
4-bromo-N-(3-fluoro-4-morpholin-4-ylphenyl)-3,5-dimethoxybenzamide (PubChem CID 56500087) has the molecular formula C19H20BrFN2O4 and a molecular weight of 439.28 g/mol. Its IUPAC name is 4-bromo-N-(3-fluoro-4-morpholin-4-ylphenyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-(3-fluoro-4-morpholin-4-ylphenyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 56500087 |
| Molecular Formula | C19H20BrFN2O4 |
| Molecular Weight | 439.28 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | 4-bromo-N-(3-fluoro-4-morpholin-4-ylphenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCOCC3)c(F)c2)cc(OC)c1Br |
| InChI | InChI=1S/C19H20BrFN2O4/c1-25-16-9-12(10-17(26-2)18(16)20)19(24)22-13-3-4-15(14(21)11-13)23-5-7-27-8-6-23/h3-4,9-11H,5-8H2,1-2H3,(H,22,24) |
| InChIKey | ZLQXUGXJWAGFDJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.28 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|