C15H12BrF2NO3 — CID 26586057
4-bromo-N-(2,4-difluorophenyl)-3,5-dimethoxybenzamide (PubChem CID 26586057) has the molecular formula C15H12BrF2NO3 and a molecular weight of 372.17 g/mol. Its IUPAC name is 4-bromo-N-(2,4-difluorophenyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-(2,4-difluorophenyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 26586057 |
| Molecular Formula | C15H12BrF2NO3 |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 4-bromo-N-(2,4-difluorophenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(F)cc2F)cc(OC)c1Br |
| InChI | InChI=1S/C15H12BrF2NO3/c1-21-12-5-8(6-13(22-2)14(12)16)15(20)19-11-4-3-9(17)7-10(11)18/h3-7H,1-2H3,(H,19,20) |
| InChIKey | PZNDGRZHSKPTFV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |