C17H17BrFNO4 — CID 86926604
3-bromo-4-ethoxy-N-(4-fluoro-2-methoxyphenyl)-5-methoxybenzamide (PubChem CID 86926604) has the molecular formula C17H17BrFNO4 and a molecular weight of 398.23 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-(4-fluoro-2-methoxyphenyl)-5-methoxybenzamide.
| Compound Name | 3-bromo-4-ethoxy-N-(4-fluoro-2-methoxyphenyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 86926604 |
| Molecular Formula | C17H17BrFNO4 |
| Molecular Weight | 398.23 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 3-bromo-4-ethoxy-N-(4-fluoro-2-methoxyphenyl)-5-methoxybenzamide |
| SMILES | CCOc1c(Br)cc(C(=O)Nc2ccc(F)cc2OC)cc1OC |
| InChI | InChI=1S/C17H17BrFNO4/c1-4-24-16-12(18)7-10(8-15(16)23-3)17(21)20-13-6-5-11(19)9-14(13)22-2/h5-9H,4H2,1-3H3,(H,20,21) |
| InChIKey | XDCYXKBELLSGCN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |