C18H19BrFNO3 — CID 7935341
3-bromo-4-ethoxy-N-[2-(4-fluorophenyl)ethyl]-5-methoxybenzamide (PubChem CID 7935341) has the molecular formula C18H19BrFNO3 and a molecular weight of 396.26 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-[2-(4-fluorophenyl)ethyl]-5-methoxybenzamide.
| Compound Name | 3-bromo-4-ethoxy-N-[2-(4-fluorophenyl)ethyl]-5-methoxybenzamide |
|---|---|
| PubChem CID | 7935341 |
| Molecular Formula | C18H19BrFNO3 |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 3-bromo-4-ethoxy-N-[2-(4-fluorophenyl)ethyl]-5-methoxybenzamide |
| SMILES | CCOc1c(Br)cc(C(=O)NCCc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C18H19BrFNO3/c1-3-24-17-15(19)10-13(11-16(17)23-2)18(22)21-9-8-12-4-6-14(20)7-5-12/h4-7,10-11H,3,8-9H2,1-2H3,(H,21,22) |
| InChIKey | XIUCLMILJDDDKZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |