C13H19BrN2O3 — CID 119499914
3-bromo-4-ethoxy-5-methoxy-N-[2-(methylamino)ethyl]benzamide (PubChem CID 119499914) has the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-5-methoxy-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-5-methoxy-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 119499914 |
| Molecular Formula | C13H19BrN2O3 |
| Molecular Weight | 331.21 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 3-bromo-4-ethoxy-5-methoxy-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CCOc1c(Br)cc(C(=O)NCCNC)cc1OC |
| InChI | InChI=1S/C13H19BrN2O3/c1-4-19-12-10(14)7-9(8-11(12)18-3)13(17)16-6-5-15-2/h7-8,15H,4-6H2,1-3H3,(H,16,17) |
| InChIKey | ACGMDTDQLQYQKU-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|