C19H22BrNO4 — CID 26181168
3-bromo-4-ethoxy-5-methoxy-N-[2-(2-methoxyphenyl)ethyl]benzamide (PubChem CID 26181168) has the molecular formula C19H22BrNO4 and a molecular weight of 408.29 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-5-methoxy-N-[2-(2-methoxyphenyl)ethyl]benzamide.
| Compound Name | 3-bromo-4-ethoxy-5-methoxy-N-[2-(2-methoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 26181168 |
| Molecular Formula | C19H22BrNO4 |
| Molecular Weight | 408.29 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-bromo-4-ethoxy-5-methoxy-N-[2-(2-methoxyphenyl)ethyl]benzamide |
| SMILES | CCOc1c(Br)cc(C(=O)NCCc2ccccc2OC)cc1OC |
| InChI | InChI=1S/C19H22BrNO4/c1-4-25-18-15(20)11-14(12-17(18)24-3)19(22)21-10-9-13-7-5-6-8-16(13)23-2/h5-8,11-12H,4,9-10H2,1-3H3,(H,21,22) |
| InChIKey | JHGUBSWGHHHXGC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |