C12H17BrN2O3 — CID 119499922
4-bromo-3,5-dimethoxy-N-[2-(methylamino)ethyl]benzamide (PubChem CID 119499922) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 119499922 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C12H17BrN2O3/c1-14-4-5-15-12(16)8-6-9(17-2)11(13)10(7-8)18-3/h6-7,14H,4-5H2,1-3H3,(H,15,16) |
| InChIKey | DGTUAVJDAPCJKK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|