C12H13BrClNO3 — CID 115636723
4-bromo-N-(2-chloroprop-2-enyl)-3,5-dimethoxybenzamide (PubChem CID 115636723) has the molecular formula C12H13BrClNO3 and a molecular weight of 334.60 g/mol. Its IUPAC name is 4-bromo-N-(2-chloroprop-2-enyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-(2-chloroprop-2-enyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 115636723 |
| Molecular Formula | C12H13BrClNO3 |
| Molecular Weight | 334.60 g/mol |
| Exact Mass | 332.98 |
| IUPAC Name | 4-bromo-N-(2-chloroprop-2-enyl)-3,5-dimethoxybenzamide |
| SMILES | C=C(Cl)CNC(=O)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C12H13BrClNO3/c1-7(14)6-15-12(16)8-4-9(17-2)11(13)10(5-8)18-3/h4-5H,1,6H2,2-3H3,(H,15,16) |
| InChIKey | LLYVFOILXPAPRM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.60 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |