C15H22BrNO4 — CID 103772465
4-bromo-N-(4-hydroxy-2,2-dimethylbutyl)-3,5-dimethoxybenzamide (PubChem CID 103772465) has the molecular formula C15H22BrNO4 and a molecular weight of 360.25 g/mol. Its IUPAC name is 4-bromo-N-(4-hydroxy-2,2-dimethylbutyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-(4-hydroxy-2,2-dimethylbutyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 103772465 |
| Molecular Formula | C15H22BrNO4 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 4-bromo-N-(4-hydroxy-2,2-dimethylbutyl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(C)(C)CCO)cc(OC)c1Br |
| InChI | InChI=1S/C15H22BrNO4/c1-15(2,5-6-18)9-17-14(19)10-7-11(20-3)13(16)12(8-10)21-4/h7-8,18H,5-6,9H2,1-4H3,(H,17,19) |
| InChIKey | GELZHORVWXUZCU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |