C15H23NO4 — CID 103772268
N-(4-hydroxy-2,2-dimethylbutyl)-2,4-dimethoxybenzamide (PubChem CID 103772268) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylbutyl)-2,4-dimethoxybenzamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylbutyl)-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 103772268 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylbutyl)-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(C)(C)CCO)c(OC)c1 |
| InChI | InChI=1S/C15H23NO4/c1-15(2,7-8-17)10-16-14(18)12-6-5-11(19-3)9-13(12)20-4/h5-6,9,17H,7-8,10H2,1-4H3,(H,16,18) |
| InChIKey | YCECFXKVDFAXSJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |