C15H22BrNO3 — CID 106145403
N-(5-bromo-2,2-dimethylpentyl)-2-hydroxy-4-methoxybenzamide (PubChem CID 106145403) has the molecular formula C15H22BrNO3 and a molecular weight of 344.25 g/mol. Its IUPAC name is N-(5-bromo-2,2-dimethylpentyl)-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-(5-bromo-2,2-dimethylpentyl)-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 106145403 |
| Molecular Formula | C15H22BrNO3 |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | N-(5-bromo-2,2-dimethylpentyl)-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC(C)(C)CCCBr)c(O)c1 |
| InChI | InChI=1S/C15H22BrNO3/c1-15(2,7-4-8-16)10-17-14(19)12-6-5-11(20-3)9-13(12)18/h5-6,9,18H,4,7-8,10H2,1-3H3,(H,17,19) |
| InChIKey | QGEGEKZFKBIVSZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|