C10H12BrNO3 — CID 47122657
4-bromo-3,5-dimethoxy-N-methylbenzamide (PubChem CID 47122657) has the molecular formula C10H12BrNO3 and a molecular weight of 274.11 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-methylbenzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 47122657 |
| Molecular Formula | C10H12BrNO3 |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(OC)c(Br)c(OC)c1 |
| InChI | InChI=1S/C10H12BrNO3/c1-12-10(13)6-4-7(14-2)9(11)8(5-6)15-3/h4-5H,1-3H3,(H,12,13) |
| InChIKey | PMJLNFKYLUDMPB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |