C16H15BrINO3 — CID 3348893
3-bromo-4-ethoxy-N-(4-iodophenyl)-5-methoxybenzamide (PubChem CID 3348893) has the molecular formula C16H15BrINO3 and a molecular weight of 476.11 g/mol. Its IUPAC name is 3-bromo-4-ethoxy-N-(4-iodophenyl)-5-methoxybenzamide.
| Compound Name | 3-bromo-4-ethoxy-N-(4-iodophenyl)-5-methoxybenzamide |
|---|---|
| PubChem CID | 3348893 |
| Molecular Formula | C16H15BrINO3 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 474.93 |
| IUPAC Name | 3-bromo-4-ethoxy-N-(4-iodophenyl)-5-methoxybenzamide |
| SMILES | CCOc1c(Br)cc(C(=O)Nc2ccc(I)cc2)cc1OC |
| InChI | InChI=1S/C16H15BrINO3/c1-3-22-15-13(17)8-10(9-14(15)21-2)16(20)19-12-6-4-11(18)5-7-12/h4-9H,3H2,1-2H3,(H,19,20) |
| InChIKey | HBVSWVIUCXETGC-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|