C16H15BrClNO4 — CID 60597741
4-bromo-N-(2-chloro-4-methoxyphenyl)-3,5-dimethoxybenzamide (PubChem CID 60597741) has the molecular formula C16H15BrClNO4 and a molecular weight of 400.66 g/mol. Its IUPAC name is 4-bromo-N-(2-chloro-4-methoxyphenyl)-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-(2-chloro-4-methoxyphenyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 60597741 |
| Molecular Formula | C16H15BrClNO4 |
| Molecular Weight | 400.66 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 4-bromo-N-(2-chloro-4-methoxyphenyl)-3,5-dimethoxybenzamide |
| SMILES | COc1ccc(NC(=O)c2cc(OC)c(Br)c(OC)c2)c(Cl)c1 |
| InChI | InChI=1S/C16H15BrClNO4/c1-21-10-4-5-12(11(18)8-10)19-16(20)9-6-13(22-2)15(17)14(7-9)23-3/h4-8H,1-3H3,(H,19,20) |
| InChIKey | KNOPQHQERZIONO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |