C8H8ClNO2S — CID 115169707
(2-chloro-4-methoxyphenyl)carbamothioic S-acid (PubChem CID 115169707) has the molecular formula C8H8ClNO2S and a molecular weight of 217.68 g/mol. Its IUPAC name is (2-chloro-4-methoxyphenyl)carbamothioic S-acid.
| Compound Name | (2-chloro-4-methoxyphenyl)carbamothioic S-acid |
|---|---|
| PubChem CID | 115169707 |
| Molecular Formula | C8H8ClNO2S |
| Molecular Weight | 217.68 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | (2-chloro-4-methoxyphenyl)carbamothioic S-acid |
| SMILES | COc1ccc(NC(=O)S)c(Cl)c1 |
| InChI | InChI=1S/C8H8ClNO2S/c1-12-5-2-3-7(6(9)4-5)10-8(11)13/h2-4H,1H3,(H2,10,11,13) |
| InChIKey | QNZDCNTVALRISP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.68 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|