C11H13ClN2O2 — CID 115189617
1-amino-N-(2-chloro-4-methoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 115189617) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is 1-amino-N-(2-chloro-4-methoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-(2-chloro-4-methoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 115189617 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-amino-N-(2-chloro-4-methoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccc(NC(=O)C2(N)CC2)c(Cl)c1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-16-7-2-3-9(8(12)6-7)14-10(15)11(13)4-5-11/h2-3,6H,4-5,13H2,1H3,(H,14,15) |
| InChIKey | UEIIOLQYWXNSOW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |