C15H21ClN2O3 — CID 86860337
N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]-3,3-dimethylbutanamide (PubChem CID 86860337) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]-3,3-dimethylbutanamide.
| Compound Name | N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 86860337 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]-3,3-dimethylbutanamide |
| SMILES | COc1ccc(NC(=O)CNC(=O)CC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O3/c1-15(2,3)8-13(19)17-9-14(20)18-12-6-5-10(21-4)7-11(12)16/h5-7H,8-9H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | MGKBTURQDJSQBW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |