C14H19ClN2O4 — CID 86860346
tert-butyl N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]carbamate (PubChem CID 86860346) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is tert-butyl N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 86860346 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | tert-butyl N-[2-(2-chloro-4-methoxyanilino)-2-oxoethyl]carbamate |
| SMILES | COc1ccc(NC(=O)CNC(=O)OC(C)(C)C)c(Cl)c1 |
| InChI | InChI=1S/C14H19ClN2O4/c1-14(2,3)21-13(19)16-8-12(18)17-11-6-5-9(20-4)7-10(11)15/h5-7H,8H2,1-4H3,(H,16,19)(H,17,18) |
| InChIKey | IFUGIAJPHPWUHJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |