C13H17FN2O4 — CID 165341337
tert-butyl N-[2-(2-fluoro-4-hydroxyanilino)-2-oxoethyl]carbamate (PubChem CID 165341337) has the molecular formula C13H17FN2O4 and a molecular weight of 284.29 g/mol. Its IUPAC name is tert-butyl N-[2-(2-fluoro-4-hydroxyanilino)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-(2-fluoro-4-hydroxyanilino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 165341337 |
| Molecular Formula | C13H17FN2O4 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | tert-butyl N-[2-(2-fluoro-4-hydroxyanilino)-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccc(O)cc1F |
| InChI | InChI=1S/C13H17FN2O4/c1-13(2,3)20-12(19)15-7-11(18)16-10-5-4-8(17)6-9(10)14/h4-6,17H,7H2,1-3H3,(H,15,19)(H,16,18) |
| InChIKey | RSKDULMIIILUHO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|